C30H12F2N4 — CID 140942918
(9Z)-9-[cyano(isocyano)methylidene]-3,6-bis(2-fluorophenyl)-7-isocyanofluorene-2-carbonitrile (PubChem CID 140942918) has the molecular formula C30H12F2N4 and a molecular weight of 466.45 g/mol. Its IUPAC name is (9Z)-9-[cyano(isocyano)methylidene]-3,6-bis(2-fluorophenyl)-7-isocyanofluorene-2-carbonitrile.
| Compound Name | (9Z)-9-[cyano(isocyano)methylidene]-3,6-bis(2-fluorophenyl)-7-isocyanofluorene-2-carbonitrile |
|---|---|
| PubChem CID | 140942918 |
| Molecular Formula | C30H12F2N4 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | (9Z)-9-[cyano(isocyano)methylidene]-3,6-bis(2-fluorophenyl)-7-isocyanofluorene-2-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2cc(C#N)c(-c3ccccc3F)cc2-c2cc(-c3ccccc3F)c([N+]#[C-])cc21 |
| InChI | InChI=1S/C30H12F2N4/c1-35-28-14-25-22(13-23(28)19-8-4-6-10-27(19)32)21-12-20(18-7-3-5-9-26(18)31)17(15-33)11-24(21)30(25)29(16-34)36-2/h3-14H/b30-29- |
| InChIKey | XJVUCBWZYXBASM-FLWNBWAVSA-N |
| XLogP | 7.90 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|