C30H10F4N4 — CID 154028917
9-(dicyanomethylidene)-3,6-bis(2,6-difluorophenyl)fluorene-2,7-dicarbonitrile (PubChem CID 154028917) has the molecular formula C30H10F4N4 and a molecular weight of 502.43 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-3,6-bis(2,6-difluorophenyl)fluorene-2,7-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-3,6-bis(2,6-difluorophenyl)fluorene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 154028917 |
| Molecular Formula | C30H10F4N4 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 9-(dicyanomethylidene)-3,6-bis(2,6-difluorophenyl)fluorene-2,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2cc(C#N)c(-c3c(F)cccc3F)cc2-c2cc(-c3c(F)cccc3F)c(C#N)cc21 |
| InChI | InChI=1S/C30H10F4N4/c31-24-3-1-4-25(32)29(24)18-9-20-21-10-19(30-26(33)5-2-6-27(30)34)16(12-36)8-23(21)28(17(13-37)14-38)22(20)7-15(18)11-35/h1-10H |
| InChIKey | QSZVFHWGXIJHJK-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|