C40H16F6N4 — CID 88881721
2-[12-(dicyanomethylidene)-2,8-bis[3-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-6-ylidene]propanedinitrile (PubChem CID 88881721) has the molecular formula C40H16F6N4 and a molecular weight of 666.58 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-2,8-bis[3-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-6-ylidene]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-2,8-bis[3-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88881721 |
| Molecular Formula | C40H16F6N4 |
| Molecular Weight | 666.58 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-2,8-bis[3-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3cccc(C(F)(F)F)c3)ccc2-c2cc3c(cc21)-c1ccc(-c2cccc(C(F)(F)F)c2)cc1C3=C(C#N)C#N |
| InChI | InChI=1S/C40H16F6N4/c41-39(42,43)27-5-1-3-21(11-27)23-7-9-29-31-15-36-32(16-35(31)37(33(29)13-23)25(17-47)18-48)30-10-8-24(14-34(30)38(36)26(19-49)20-50)22-4-2-6-28(12-22)40(44,45)46/h1-16H |
| InChIKey | CYARXPZPICJOKV-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.58 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|