C43H16F12N4 — CID 139501357
2-[2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-8-[3,5-bis(trifluoromethyl)phenyl]-12-(dicyanomethylidene)indeno[2,1-b]fluoren-10-ylidene]propanedinitrile (PubChem CID 139501357) has the molecular formula C43H16F12N4 and a molecular weight of 816.60 g/mol. Its IUPAC name is 2-[2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-8-[3,5-bis(trifluoromethyl)phenyl]-12-(dicyanomethylidene)indeno[2,1-b]fluoren-10-ylidene]propanedinitrile.
| Compound Name | 2-[2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-8-[3,5-bis(trifluoromethyl)phenyl]-12-(dicyanomethylidene)indeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139501357 |
| Molecular Formula | C43H16F12N4 |
| Molecular Weight | 816.60 g/mol |
| Exact Mass | 816.12 |
| IUPAC Name | 2-[2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-8-[3,5-bis(trifluoromethyl)phenyl]-12-(dicyanomethylidene)indeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(C3=CCC(C(F)(F)F)=CC(C(F)(F)F)=C3)ccc2-c2cc3c(cc21)C(=C(C#N)C#N)c1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1-3 |
| InChI | InChI=1S/C43H16F12N4/c44-40(45,46)26-4-1-20(7-27(12-26)41(47,48)49)21-2-5-30-32-14-33-31-6-3-22(23-8-28(42(50,51)52)13-29(9-23)43(53,54)55)11-35(31)39(25(18-58)19-59)37(33)15-36(32)38(34(30)10-21)24(16-56)17-57/h1-3,5-15H,4H2 |
| InChIKey | AMZHOOSKUYCOOB-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.60 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|