C44H14F12N4O2 — CID 139501730
2-[2,8-bis[3,5-bis(trifluoromethyl)benzoyl]-10-(dicyanomethylidene)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile (PubChem CID 139501730) has the molecular formula C44H14F12N4O2 and a molecular weight of 858.60 g/mol. Its IUPAC name is 2-[2,8-bis[3,5-bis(trifluoromethyl)benzoyl]-10-(dicyanomethylidene)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile.
| Compound Name | 2-[2,8-bis[3,5-bis(trifluoromethyl)benzoyl]-10-(dicyanomethylidene)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139501730 |
| Molecular Formula | C44H14F12N4O2 |
| Molecular Weight | 858.60 g/mol |
| Exact Mass | 858.09 |
| IUPAC Name | 2-[2,8-bis[3,5-bis(trifluoromethyl)benzoyl]-10-(dicyanomethylidene)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2-c2cc3c(cc21)C(=C(C#N)C#N)c1cc(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1-3 |
| InChI | InChI=1S/C44H14F12N4O2/c45-41(46,47)25-5-21(6-26(11-25)42(48,49)50)39(61)19-1-3-29-31-13-32-30-4-2-20(40(62)22-7-27(43(51,52)53)12-28(8-22)44(54,55)56)10-34(30)38(24(17-59)18-60)36(32)14-35(31)37(33(29)9-19)23(15-57)16-58/h1-14H |
| InChIKey | SFNYONYHMXBSGT-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 129.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.60 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|