C46H18F18N2O2 — CID 146535635
2-[3,6-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile (PubChem CID 146535635) has the molecular formula C46H18F18N2O2 and a molecular weight of 972.63 g/mol. Its IUPAC name is 2-[3,6-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[3,6-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 146535635 |
| Molecular Formula | C46H18F18N2O2 |
| Molecular Weight | 972.63 g/mol |
| Exact Mass | 972.11 |
| IUPAC Name | 2-[3,6-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(OC(F)(F)F)c(-c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc2-c2cc(-c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)c(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C46H18F18N2O2/c47-41(48,49)28-9-25(10-29(13-28)42(50,51)52)21-1-5-23(6-2-21)32-15-34-35-16-33(24-7-3-22(4-8-24)26-11-30(43(53,54)55)14-31(12-26)44(56,57)58)39(68-46(62,63)64)18-37(35)40(27(19-65)20-66)36(34)17-38(32)67-45(59,60)61/h1-18H |
| InChIKey | LGPSDLJOMLJTHC-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.63 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|