C30H6F6N6 — CID 90206157
10,12-bis(dicyanomethylidene)-2,8-bis(trifluoromethyl)indeno[2,1-b]fluorene-1,7-dicarbonitrile (PubChem CID 90206157) has the molecular formula C30H6F6N6 and a molecular weight of 564.41 g/mol. Its IUPAC name is 10,12-bis(dicyanomethylidene)-2,8-bis(trifluoromethyl)indeno[2,1-b]fluorene-1,7-dicarbonitrile.
| Compound Name | 10,12-bis(dicyanomethylidene)-2,8-bis(trifluoromethyl)indeno[2,1-b]fluorene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 90206157 |
| Molecular Formula | C30H6F6N6 |
| Molecular Weight | 564.41 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | 10,12-bis(dicyanomethylidene)-2,8-bis(trifluoromethyl)indeno[2,1-b]fluorene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2cc(C(F)(F)F)c(C#N)cc2-c2cc3c(cc21)C(=C(C#N)C#N)c1c-3ccc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C30H6F6N6/c31-29(32,33)24-2-1-16-18-4-19-17-3-13(7-37)25(30(34,35)36)6-22(17)26(14(8-38)9-39)20(19)5-21(18)27(15(10-40)11-41)28(16)23(24)12-42/h1-6H |
| InChIKey | WHUTXZKWZGUQFV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.41 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|