C39H5F18N7 — CID 175631779
3,7-bis(dicyanomethylidene)-2,6-bis[3,4,5-tris(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile (PubChem CID 175631779) has the molecular formula C39H5F18N7 and a molecular weight of 913.48 g/mol. Its IUPAC name is 3,7-bis(dicyanomethylidene)-2,6-bis[3,4,5-tris(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile.
| Compound Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4,5-tris(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 175631779 |
| Molecular Formula | C39H5F18N7 |
| Molecular Weight | 913.48 g/mol |
| Exact Mass | 913.03 |
| IUPAC Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4,5-tris(trifluoromethyl)phenyl]-s-indacene-1,4,5-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2C#N)C(=C(C#N)C#N)C(c2cc(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c2)=C1C#N |
| InChI | InChI=1S/C39H5F18N7/c40-34(41,42)22-1-13(2-23(35(43,44)45)32(22)38(52,53)54)26-19(10-62)17-5-18-28(15(6-58)7-59)27(20(11-63)30(18)21(12-64)31(17)29(26)16(8-60)9-61)14-3-24(36(46,47)48)33(39(55,56)57)25(4-14)37(49,50)51/h1-5H |
| InChIKey | UBVHWSVMILAEMK-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.48 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|