C36H4F10N8 — CID 175622864
3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5,8-tetracarbonitrile (PubChem CID 175622864) has the molecular formula C36H4F10N8 and a molecular weight of 738.46 g/mol. Its IUPAC name is 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5,8-tetracarbonitrile.
| Compound Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5,8-tetracarbonitrile |
|---|---|
| PubChem CID | 175622864 |
| Molecular Formula | C36H4F10N8 |
| Molecular Weight | 738.46 g/mol |
| Exact Mass | 738.04 |
| IUPAC Name | 3,7-bis(dicyanomethylidene)-2,6-bis[3,4-difluoro-5-(trifluoromethyl)phenyl]-s-indacene-1,4,5,8-tetracarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(F)c(F)c(C(F)(F)F)c2)=C(C#N)c2c(C#N)c3c(c(C#N)c21)C(C#N)=C(c1cc(F)c(F)c(C(F)(F)F)c1)C3=C(C#N)C#N |
| InChI | InChI=1S/C36H4F10N8/c37-23-3-13(1-21(33(23)39)35(41,42)43)25-17(9-51)29-19(11-53)32-28(16(7-49)8-50)26(14-2-22(36(44,45)46)34(40)24(38)4-14)18(10-52)30(32)20(12-54)31(29)27(25)15(5-47)6-48/h1-4H |
| InChIKey | ZCSXLUYGSPNREZ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.46 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|