C36H7F13N6 — CID 175621833
2,6-bis[3,4-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile (PubChem CID 175621833) has the molecular formula C36H7F13N6 and a molecular weight of 770.47 g/mol. Its IUPAC name is 2,6-bis[3,4-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2,6-bis[3,4-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 175621833 |
| Molecular Formula | C36H7F13N6 |
| Molecular Weight | 770.47 g/mol |
| Exact Mass | 770.05 |
| IUPAC Name | 2,6-bis[3,4-bis(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-8-fluoro-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C(F)(F)F)c(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2F)C(C#N)=C(c2ccc(C(F)(F)F)c(C(F)(F)F)c2)C1=C(C#N)C#N |
| InChI | InChI=1S/C36H7F13N6/c37-32-30-18(28(16(8-50)9-51)26(20(30)12-54)14-1-3-22(33(38,39)40)24(5-14)35(44,45)46)7-19-29(17(10-52)11-53)27(21(13-55)31(19)32)15-2-4-23(34(41,42)43)25(6-15)36(47,48)49/h1-7H |
| InChIKey | OPEIVUBCXUCQKV-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.47 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|