C38H6F9N9 — CID 167122058
2-[3,4-bis(trifluoromethyl)phenyl]-6-[3-cyano-4-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile (PubChem CID 167122058) has the molecular formula C38H6F9N9 and a molecular weight of 759.51 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)phenyl]-6-[3-cyano-4-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile.
| Compound Name | 2-[3,4-bis(trifluoromethyl)phenyl]-6-[3-cyano-4-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile |
|---|---|
| PubChem CID | 167122058 |
| Molecular Formula | C38H6F9N9 |
| Molecular Weight | 759.51 g/mol |
| Exact Mass | 759.06 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)phenyl]-6-[3-cyano-4-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,4,7,8-tetracarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C(F)(F)F)c(C#N)c2)=C(C#N)c2c(C#N)c3c(c(C#N)c21)C(=C(C#N)C#N)C(c1ccc(C(F)(F)F)c(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C38H6F9N9/c39-36(40,41)25-3-1-16(5-18(25)7-48)28-21(12-53)32-23(14-55)33-22(13-54)29(17-2-4-26(37(42,43)44)27(6-17)38(45,46)47)31(20(10-51)11-52)35(33)24(15-56)34(32)30(28)19(8-49)9-50/h1-6H |
| InChIKey | BERFTHDCQWVHOZ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.51 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|