C36H8F9N7 — CID 167125320
2-[3,4-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile (PubChem CID 167125320) has the molecular formula C36H8F9N7 and a molecular weight of 709.49 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile.
| Compound Name | 2-[3,4-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 167125320 |
| Molecular Formula | C36H8F9N7 |
| Molecular Weight | 709.49 g/mol |
| Exact Mass | 709.07 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)phenyl]-6-[4-cyano-3-(trifluoromethyl)phenyl]-3,5-bis(dicyanomethylidene)-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C#N)c(C(F)(F)F)c2)=C(C#N)c2cc3c(cc21)C(=C(C#N)C#N)C(c1ccc(C(F)(F)F)c(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C36H8F9N7/c37-34(38,39)27-4-3-17(6-29(27)36(43,44)45)31-26(15-52)22-7-21-23(8-24(22)33(31)20(12-49)13-50)32(19(10-47)11-48)30(25(21)14-51)16-1-2-18(9-46)28(5-16)35(40,41)42/h1-8H |
| InChIKey | NOWCBEWFLBYNGO-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.49 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|