C36H8F3N9O — CID 167125556
2-[3-cyano-4-(trifluoromethoxy)phenyl]-3,7-bis(dicyanomethylidene)-6-(3,4-dicyanophenyl)-s-indacene-1,5-dicarbonitrile (PubChem CID 167125556) has the molecular formula C36H8F3N9O and a molecular weight of 639.52 g/mol. Its IUPAC name is 2-[3-cyano-4-(trifluoromethoxy)phenyl]-3,7-bis(dicyanomethylidene)-6-(3,4-dicyanophenyl)-s-indacene-1,5-dicarbonitrile.
| Compound Name | 2-[3-cyano-4-(trifluoromethoxy)phenyl]-3,7-bis(dicyanomethylidene)-6-(3,4-dicyanophenyl)-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 167125556 |
| Molecular Formula | C36H8F3N9O |
| Molecular Weight | 639.52 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | 2-[3-cyano-4-(trifluoromethoxy)phenyl]-3,7-bis(dicyanomethylidene)-6-(3,4-dicyanophenyl)-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C#N)c(C#N)c2)=C(C#N)c2cc3c(cc21)C(C#N)=C(c1ccc(OC(F)(F)F)c(C#N)c1)C3=C(C#N)C#N |
| InChI | InChI=1S/C36H8F3N9O/c37-36(38,39)49-31-4-3-19(6-22(31)11-42)33-30(17-48)26-8-27-25(7-28(26)35(33)24(14-45)15-46)29(16-47)32(34(27)23(12-43)13-44)18-1-2-20(9-40)21(5-18)10-41/h1-8H |
| InChIKey | WMKINSHSJFFPIT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 223.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|