C22H2F6N6O2 — CID 129206093
3,5-bis(dicyanomethylidene)-2,6-bis(trifluoromethoxy)-s-indacene-1,7-dicarbonitrile (PubChem CID 129206093) has the molecular formula C22H2F6N6O2 and a molecular weight of 496.29 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-2,6-bis(trifluoromethoxy)-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-2,6-bis(trifluoromethoxy)-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 129206093 |
| Molecular Formula | C22H2F6N6O2 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-2,6-bis(trifluoromethoxy)-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(OC(F)(F)F)=C(C#N)c2cc3c(cc21)C(=C(C#N)C#N)C(OC(F)(F)F)=C3C#N |
| InChI | InChI=1S/C22H2F6N6O2/c23-21(24,25)35-19-15(7-33)11-1-12-14(2-13(11)17(19)9(3-29)4-30)18(10(5-31)6-32)20(16(12)8-34)36-22(26,27)28/h1-2H |
| InChIKey | QULBQPWOGXSOPJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 161.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|