C32H12F6N4O2 — CID 154028905
9-(dicyanomethylidene)-3,6-bis[4-(trifluoromethoxy)phenyl]fluorene-2,7-dicarbonitrile (PubChem CID 154028905) has the molecular formula C32H12F6N4O2 and a molecular weight of 598.46 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-3,6-bis[4-(trifluoromethoxy)phenyl]fluorene-2,7-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-3,6-bis[4-(trifluoromethoxy)phenyl]fluorene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 154028905 |
| Molecular Formula | C32H12F6N4O2 |
| Molecular Weight | 598.46 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 9-(dicyanomethylidene)-3,6-bis[4-(trifluoromethoxy)phenyl]fluorene-2,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2cc(C#N)c(-c3ccc(OC(F)(F)F)cc3)cc2-c2cc(-c3ccc(OC(F)(F)F)cc3)c(C#N)cc21 |
| InChI | InChI=1S/C32H12F6N4O2/c33-31(34,35)43-22-5-1-17(2-6-22)24-11-26-27-12-25(18-3-7-23(8-4-18)44-32(36,37)38)20(14-40)10-29(27)30(21(15-41)16-42)28(26)9-19(24)13-39/h1-12H |
| InChIKey | VWDKPCMIMHFCGU-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.46 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|