C31H9F6N5O — CID 121371787
2-[2-[1-cyano-3-(dicyanomethylidene)-5-(trifluoromethoxy)inden-2-yl]-7-(trifluoromethyl)fluoren-9-ylidene]propanedinitrile (PubChem CID 121371787) has the molecular formula C31H9F6N5O and a molecular weight of 581.44 g/mol. Its IUPAC name is 2-[2-[1-cyano-3-(dicyanomethylidene)-5-(trifluoromethoxy)inden-2-yl]-7-(trifluoromethyl)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[2-[1-cyano-3-(dicyanomethylidene)-5-(trifluoromethoxy)inden-2-yl]-7-(trifluoromethyl)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 121371787 |
| Molecular Formula | C31H9F6N5O |
| Molecular Weight | 581.44 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | 2-[2-[1-cyano-3-(dicyanomethylidene)-5-(trifluoromethoxy)inden-2-yl]-7-(trifluoromethyl)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc3c(c2)C(=C(C#N)C#N)c2cc(C(F)(F)F)ccc2-3)=C(C#N)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C31H9F6N5O/c32-30(33,34)18-2-5-21-20-4-1-15(7-23(20)27(24(21)8-18)16(10-38)11-39)28-26(14-42)22-6-3-19(43-31(35,36)37)9-25(22)29(28)17(12-40)13-41/h1-9H |
| InChIKey | PDWXQTHLPWITAY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.44 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|