C32H10F8N4O2 — CID 146535483
2-[3,6-bis(4-cyano-3-fluorophenyl)-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile (PubChem CID 146535483) has the molecular formula C32H10F8N4O2 and a molecular weight of 634.44 g/mol. Its IUPAC name is 2-[3,6-bis(4-cyano-3-fluorophenyl)-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[3,6-bis(4-cyano-3-fluorophenyl)-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 146535483 |
| Molecular Formula | C32H10F8N4O2 |
| Molecular Weight | 634.44 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | 2-[3,6-bis(4-cyano-3-fluorophenyl)-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(OC(F)(F)F)c(-c3ccc(C#N)c(F)c3)cc2-c2cc(-c3ccc(C#N)c(F)c3)c(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C32H10F8N4O2/c33-26-5-15(1-3-17(26)11-41)20-7-22-23-8-21(16-2-4-18(12-42)27(34)6-16)29(46-32(38,39)40)10-25(23)30(19(13-43)14-44)24(22)9-28(20)45-31(35,36)37/h1-10H |
| InChIKey | XSSBGERJDPXREU-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.44 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|