C36H12F20N2O4 — CID 166813981
2-[3,6-bis[3-fluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile (PubChem CID 166813981) has the molecular formula C36H12F20N2O4 and a molecular weight of 916.46 g/mol. Its IUPAC name is 2-[3,6-bis[3-fluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[3,6-bis[3-fluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 166813981 |
| Molecular Formula | C36H12F20N2O4 |
| Molecular Weight | 916.46 g/mol |
| Exact Mass | 916.05 |
| IUPAC Name | 2-[3,6-bis[3-fluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2,7-bis(trifluoromethoxy)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(OC(F)(F)F)c(-c3ccc(OC(C(F)(F)F)C(F)(F)F)c(F)c3)cc2-c2cc(-c3ccc(OC(C(F)(F)F)C(F)(F)F)c(F)c3)c(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C36H12F20N2O4/c37-22-5-13(1-3-24(22)59-29(31(39,40)41)32(42,43)44)16-7-18-19-8-17(14-2-4-25(23(38)6-14)60-30(33(45,46)47)34(48,49)50)27(62-36(54,55)56)10-21(19)28(15(11-57)12-58)20(18)9-26(16)61-35(51,52)53/h1-10,29-30H |
| InChIKey | GOECCHKJCJOOAG-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.46 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|