C30H8F12N2O2 — CID 166814027
2-[2,7-bis(trifluoromethoxy)-3,6-bis(2,4,6-trifluorophenyl)fluoren-9-ylidene]propanedinitrile (PubChem CID 166814027) has the molecular formula C30H8F12N2O2 and a molecular weight of 656.38 g/mol. Its IUPAC name is 2-[2,7-bis(trifluoromethoxy)-3,6-bis(2,4,6-trifluorophenyl)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[2,7-bis(trifluoromethoxy)-3,6-bis(2,4,6-trifluorophenyl)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 166814027 |
| Molecular Formula | C30H8F12N2O2 |
| Molecular Weight | 656.38 g/mol |
| Exact Mass | 656.04 |
| IUPAC Name | 2-[2,7-bis(trifluoromethoxy)-3,6-bis(2,4,6-trifluorophenyl)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(OC(F)(F)F)c(-c3c(F)cc(F)cc3F)cc2-c2cc(-c3c(F)cc(F)cc3F)c(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C30H8F12N2O2/c31-12-1-20(33)27(21(34)2-12)18-5-14-15-6-19(28-22(35)3-13(32)4-23(28)36)25(46-30(40,41)42)8-17(15)26(11(9-43)10-44)16(14)7-24(18)45-29(37,38)39/h1-8H |
| InChIKey | RMOZIOVJQFXIKE-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.38 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|