C20H4F6N4O2 — CID 146535611
9-(dicyanomethylidene)-3,6-bis(trifluoromethoxy)fluorene-2,7-dicarbonitrile (PubChem CID 146535611) has the molecular formula C20H4F6N4O2 and a molecular weight of 446.27 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-3,6-bis(trifluoromethoxy)fluorene-2,7-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-3,6-bis(trifluoromethoxy)fluorene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 146535611 |
| Molecular Formula | C20H4F6N4O2 |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 9-(dicyanomethylidene)-3,6-bis(trifluoromethoxy)fluorene-2,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2cc(C#N)c(OC(F)(F)F)cc2-c2cc(OC(F)(F)F)c(C#N)cc21 |
| InChI | InChI=1S/C20H4F6N4O2/c21-19(22,23)31-16-3-12-13-4-17(32-20(24,25)26)10(6-28)2-15(13)18(11(7-29)8-30)14(12)1-9(16)5-27/h1-4H |
| InChIKey | AMCXJVSZLRQBPD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|