C10H6F3NO3S — CID 118816556
2-[4-cyano-2-sulfanyl-5-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 118816556) has the molecular formula C10H6F3NO3S and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-[4-cyano-2-sulfanyl-5-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[4-cyano-2-sulfanyl-5-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 118816556 |
| Molecular Formula | C10H6F3NO3S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 2-[4-cyano-2-sulfanyl-5-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | N#Cc1cc(S)c(CC(=O)O)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H6F3NO3S/c11-10(12,13)17-7-1-5(3-9(15)16)8(18)2-6(7)4-14/h1-2,18H,3H2,(H,15,16) |
| InChIKey | HVYKWFWQEVVJAD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|