C11H8F3NO3 — CID 135743465
2-[4-cyano-5-methyl-2-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 135743465) has the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. Its IUPAC name is 2-[4-cyano-5-methyl-2-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[4-cyano-5-methyl-2-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 135743465 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[4-cyano-5-methyl-2-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)c(OC(F)(F)F)cc1C#N |
| InChI | InChI=1S/C11H8F3NO3/c1-6-2-7(4-10(16)17)9(3-8(6)5-15)18-11(12,13)14/h2-3H,4H2,1H3,(H,16,17) |
| InChIKey | YTEAAXVVBGPLQJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |