C12H9F3INO3 — CID 134654666
ethyl 2-[5-cyano-4-iodo-2-(trifluoromethoxy)phenyl]acetate (PubChem CID 134654666) has the molecular formula C12H9F3INO3 and a molecular weight of 399.11 g/mol. Its IUPAC name is ethyl 2-[5-cyano-4-iodo-2-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[5-cyano-4-iodo-2-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134654666 |
| Molecular Formula | C12H9F3INO3 |
| Molecular Weight | 399.11 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | ethyl 2-[5-cyano-4-iodo-2-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C#N)c(I)cc1OC(F)(F)F |
| InChI | InChI=1S/C12H9F3INO3/c1-2-19-11(18)4-7-3-8(6-17)9(16)5-10(7)20-12(13,14)15/h3,5H,2,4H2,1H3 |
| InChIKey | XAZUGAJLQCEWMM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|