C13H12F3NO4 — CID 134655313
ethyl 2-[2-cyano-4-methoxy-6-(trifluoromethoxy)phenyl]acetate (PubChem CID 134655313) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is ethyl 2-[2-cyano-4-methoxy-6-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-4-methoxy-6-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134655313 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | ethyl 2-[2-cyano-4-methoxy-6-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(C#N)cc(OC)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO4/c1-3-20-12(18)6-10-8(7-17)4-9(19-2)5-11(10)21-13(14,15)16/h4-5H,3,6H2,1-2H3 |
| InChIKey | NOCYFMFDBJIYPV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |