C13H9F6NO3 — CID 134653867
ethyl 2-[4-cyano-2-(trifluoromethoxy)-6-(trifluoromethyl)phenyl]acetate (PubChem CID 134653867) has the molecular formula C13H9F6NO3 and a molecular weight of 341.21 g/mol. Its IUPAC name is ethyl 2-[4-cyano-2-(trifluoromethoxy)-6-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-2-(trifluoromethoxy)-6-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134653867 |
| Molecular Formula | C13H9F6NO3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | ethyl 2-[4-cyano-2-(trifluoromethoxy)-6-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(OC(F)(F)F)cc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9F6NO3/c1-2-22-11(21)5-8-9(12(14,15)16)3-7(6-20)4-10(8)23-13(17,18)19/h3-4H,2,5H2,1H3 |
| InChIKey | YERWYSOYZHFRDC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |