C38H12F6N6O2 — CID 155003127
2-[1,6-bis[4-cyano-2-(trifluoromethoxy)phenyl]-10-(dicyanomethylidene)indeno[2,1-a]inden-5-ylidene]propanedinitrile (PubChem CID 155003127) has the molecular formula C38H12F6N6O2 and a molecular weight of 698.54 g/mol. Its IUPAC name is 2-[1,6-bis[4-cyano-2-(trifluoromethoxy)phenyl]-10-(dicyanomethylidene)indeno[2,1-a]inden-5-ylidene]propanedinitrile.
| Compound Name | 2-[1,6-bis[4-cyano-2-(trifluoromethoxy)phenyl]-10-(dicyanomethylidene)indeno[2,1-a]inden-5-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 155003127 |
| Molecular Formula | C38H12F6N6O2 |
| Molecular Weight | 698.54 g/mol |
| Exact Mass | 698.09 |
| IUPAC Name | 2-[1,6-bis[4-cyano-2-(trifluoromethoxy)phenyl]-10-(dicyanomethylidene)indeno[2,1-a]inden-5-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2=C(C(=C(C#N)C#N)c3c2cccc3-c2ccc(C#N)cc2OC(F)(F)F)c2cccc(-c3ccc(C#N)cc3OC(F)(F)F)c21 |
| InChI | InChI=1S/C38H12F6N6O2/c39-37(40,41)51-29-11-19(13-45)7-9-23(29)25-3-1-5-27-33(25)31(21(15-47)16-48)36-28-6-2-4-26(34(28)32(35(27)36)22(17-49)18-50)24-10-8-20(14-46)12-30(24)52-38(42,43)44/h1-12H |
| InChIKey | JAZUYZFWSICBIH-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 161.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.54 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|