C31H14F6N4O — CID 167255335
2-[10-(dicyanomethylidene)-2-(4,4,4-trifluorobutyl)-8-(trifluoromethoxy)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile (PubChem CID 167255335) has the molecular formula C31H14F6N4O and a molecular weight of 572.47 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2-(4,4,4-trifluorobutyl)-8-(trifluoromethoxy)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2-(4,4,4-trifluorobutyl)-8-(trifluoromethoxy)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 167255335 |
| Molecular Formula | C31H14F6N4O |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2-(4,4,4-trifluorobutyl)-8-(trifluoromethoxy)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(CCCC(F)(F)F)ccc2-c2cc3c(cc21)C(=C(C#N)C#N)c1cc(OC(F)(F)F)ccc1-3 |
| InChI | InChI=1S/C31H14F6N4O/c32-30(33,34)7-1-2-16-3-5-20-22-10-23-21-6-4-19(42-31(35,36)37)9-25(21)29(18(14-40)15-41)27(23)11-26(22)28(24(20)8-16)17(12-38)13-39/h3-6,8-11H,1-2,7H2 |
| InChIKey | ZLLAPUPYLKKRGS-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|