C22H2N8 — CID 177279500
3,5-bis(dicyanomethylidene)-6,7-diisocyano-s-indacene-1,2-dicarbonitrile (PubChem CID 177279500) has the molecular formula C22H2N8 and a molecular weight of 378.31 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-6,7-diisocyano-s-indacene-1,2-dicarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-6,7-diisocyano-s-indacene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 177279500 |
| Molecular Formula | C22H2N8 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-6,7-diisocyano-s-indacene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C([N+]#[C-])c2cc3c(cc2C1=C(C#N)C#N)C(=C(C#N)C#N)C(C#N)=C3C#N |
| InChI | InChI=1S/C22H2N8/c1-29-21-16-3-13-14(4-15(16)20(22(21)30-2)12(7-25)8-26)19(11(5-23)6-24)18(10-28)17(13)9-27/h3-4H |
| InChIKey | RDMFCSZKQPXVLU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 151.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|