C36H8N10 — CID 153489575
5-[(3E,5Z)-1-cyano-3,5-bis[cyano(isocyano)methylidene]-6-(3,5-diisocyanophenyl)-7-isocyano-s-indacen-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 153489575) has the molecular formula C36H8N10 and a molecular weight of 580.53 g/mol. Its IUPAC name is 5-[(3E,5Z)-1-cyano-3,5-bis[cyano(isocyano)methylidene]-6-(3,5-diisocyanophenyl)-7-isocyano-s-indacen-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[(3E,5Z)-1-cyano-3,5-bis[cyano(isocyano)methylidene]-6-(3,5-diisocyanophenyl)-7-isocyano-s-indacen-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 153489575 |
| Molecular Formula | C36H8N10 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 5-[(3E,5Z)-1-cyano-3,5-bis[cyano(isocyano)methylidene]-6-(3,5-diisocyanophenyl)-7-isocyano-s-indacen-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc([N+]#[C-])cc([N+]#[C-])c2)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)C(C#N)=C(c1cc(C#N)cc(C#N)c1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C36H8N10/c1-42-23-9-22(10-24(11-23)43-2)33-35(31(18-41)45-4)27-13-26-25(12-28(27)36(33)46-5)29(16-39)32(34(26)30(17-40)44-3)21-7-19(14-37)6-20(8-21)15-38/h6-13H/b34-30+,35-31- |
| InChIKey | YATFDVKHVPDPAN-CKROKQIASA-N |
| XLogP | 8.09 |
| TPSA | 140.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|