C34H2F8N8 — CID 153489521
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5,6-tetrafluorophenyl)-7-isocyano-6-(2,3,5,6-tetrafluoro-4-isocyanophenyl)-s-indacene-1-carbonitrile (PubChem CID 153489521) has the molecular formula C34H2F8N8 and a molecular weight of 674.43 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5,6-tetrafluorophenyl)-7-isocyano-6-(2,3,5,6-tetrafluoro-4-isocyanophenyl)-s-indacene-1-carbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5,6-tetrafluorophenyl)-7-isocyano-6-(2,3,5,6-tetrafluoro-4-isocyanophenyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 153489521 |
| Molecular Formula | C34H2F8N8 |
| Molecular Weight | 674.43 g/mol |
| Exact Mass | 674.03 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyano-2,3,5,6-tetrafluorophenyl)-7-isocyano-6-(2,3,5,6-tetrafluoro-4-isocyanophenyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2c(F)c(F)c([N+]#[C-])c(F)c2F)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)C(C#N)=C(c1c(F)c(F)c(C#N)c(F)c1F)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C34H2F8N8/c1-47-17(9-45)19-12-6-13-14(5-11(12)15(7-43)21(19)23-27(37)25(35)16(8-44)26(36)28(23)38)33(49-3)22(20(13)18(10-46)48-2)24-29(39)31(41)34(50-4)32(42)30(24)40/h5-6H/b19-17+,20-18- |
| InChIKey | QAEPMSSYJQROQW-NADBREJJSA-N |
| XLogP | 8.78 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.43 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|