C34H5F5N8 — CID 168832493
(3Z,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile (PubChem CID 168832493) has the molecular formula C34H5F5N8 and a molecular weight of 620.46 g/mol. Its IUPAC name is (3Z,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile.
| Compound Name | (3Z,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 168832493 |
| Molecular Formula | C34H5F5N8 |
| Molecular Weight | 620.46 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | (3Z,7Z)-2-(4-cyano-2,6-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,6-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2c(F)cc([N+]#[C-])cc2F)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(F)c21)/C(=C(/C#N)[N+]#[C-])C(c1c(F)cc(C#N)cc1F)=C3C#N |
| InChI | InChI=1S/C34H5F5N8/c1-44-15-7-21(37)30(22(38)8-15)32-25(23(12-42)45-2)17-9-16-18(11-41)26(29-19(35)5-14(10-40)6-20(29)36)31(24(13-43)46-3)27(16)33(39)28(17)34(32)47-4/h5-9H/b25-23-,31-24- |
| InChIKey | DGRWWKRORSWALI-RRBAQHBPSA-N |
| XLogP | 8.36 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.46 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|