C33H5F4N9 — CID 171766886
3-[(1E,7Z)-3-cyano-1,7-bis[cyano(isocyano)methylidene]-6-(2,5-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacen-2-yl]-6-fluoropyridine-2-carbonitrile (PubChem CID 171766886) has the molecular formula C33H5F4N9 and a molecular weight of 603.46 g/mol. Its IUPAC name is 3-[(1E,7Z)-3-cyano-1,7-bis[cyano(isocyano)methylidene]-6-(2,5-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacen-2-yl]-6-fluoropyridine-2-carbonitrile.
| Compound Name | 3-[(1E,7Z)-3-cyano-1,7-bis[cyano(isocyano)methylidene]-6-(2,5-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacen-2-yl]-6-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171766886 |
| Molecular Formula | C33H5F4N9 |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 603.06 |
| IUPAC Name | 3-[(1E,7Z)-3-cyano-1,7-bis[cyano(isocyano)methylidene]-6-(2,5-difluoro-4-isocyanophenyl)-4-fluoro-5-isocyano-s-indacen-2-yl]-6-fluoropyridine-2-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc(F)c([N+]#[C-])cc2F)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(F)c21)C(C#N)=C(c1ccc(F)nc1C#N)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C33H5F4N9/c1-42-21-9-19(34)15(8-20(21)35)30-29(24(13-41)44-3)17-7-16-27(32(37)31(17)33(30)45-4)18(10-38)26(28(16)23(12-40)43-2)14-5-6-25(36)46-22(14)11-39/h5-9H/b28-23+,29-24- |
| InChIKey | VSWKPUGCWPDLFL-ABHBNJMISA-N |
| XLogP | 7.62 |
| TPSA | 125.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|