C34H12FN7 — CID 164976247
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyanophenyl)-8-fluoro-7-isocyano-6-(4-methylphenyl)-s-indacene-1-carbonitrile (PubChem CID 164976247) has the molecular formula C34H12FN7 and a molecular weight of 537.52 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyanophenyl)-8-fluoro-7-isocyano-6-(4-methylphenyl)-s-indacene-1-carbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyanophenyl)-8-fluoro-7-isocyano-6-(4-methylphenyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 164976247 |
| Molecular Formula | C34H12FN7 |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2-(4-cyanophenyl)-8-fluoro-7-isocyano-6-(4-methylphenyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(C)cc2)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(F)c21)C(C#N)=C(c1ccc(C#N)cc1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C34H12FN7/c1-18-5-9-21(10-6-18)28-31(26(17-39)41-3)23-13-22-29(33(35)32(23)34(28)42-4)24(15-37)27(30(22)25(16-38)40-2)20-11-7-19(14-36)8-12-20/h5-13H,1H3/b30-25+,31-26- |
| InChIKey | WLACOSKIQAHQPS-BENVAKDZSA-N |
| XLogP | 7.56 |
| TPSA | 108.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|