C36H9F5N8 — CID 158132485
(3Z,7E)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-4,8-difluoro-5-isocyano-6-(3-isocyano-4-methylphenyl)-s-indacene-1-carbonitrile (PubChem CID 158132485) has the molecular formula C36H9F5N8 and a molecular weight of 648.51 g/mol. Its IUPAC name is (3Z,7E)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-4,8-difluoro-5-isocyano-6-(3-isocyano-4-methylphenyl)-s-indacene-1-carbonitrile.
| Compound Name | (3Z,7E)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-4,8-difluoro-5-isocyano-6-(3-isocyano-4-methylphenyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 158132485 |
| Molecular Formula | C36H9F5N8 |
| Molecular Weight | 648.51 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | (3Z,7E)-3,7-bis[cyano(isocyano)methylidene]-2-[3-cyano-4-(trifluoromethyl)phenyl]-4,8-difluoro-5-isocyano-6-(3-isocyano-4-methylphenyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(C)c([N+]#[C-])c2)/C(=C(/C#N)[N+]#[C-])c2c(F)c3c(c(F)c21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C(F)(F)F)c(C#N)c1)=C3C#N |
| InChI | InChI=1S/C36H9F5N8/c1-16-6-7-18(11-22(16)46-2)26-29(24(15-45)48-4)31-32(35(26)49-5)34(38)30-27(33(31)37)20(13-43)25(28(30)23(14-44)47-3)17-8-9-21(36(39,40)41)19(10-17)12-42/h6-11H,1H3/b28-23-,29-24+ |
| InChIKey | PWALHPQJNURXBE-CELGBUAWSA-N |
| XLogP | 9.27 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.51 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|