C29H3F8N5 — CID 140872812
(2Z)-2-[7-[(1E)-1-[cyano(isocyano)methylidene]-4,5,6,7-tetrafluoro-3-isocyanoinden-2-yl]-1,2,3,4-tetrafluorofluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 140872812) has the molecular formula C29H3F8N5 and a molecular weight of 573.36 g/mol. Its IUPAC name is (2Z)-2-[7-[(1E)-1-[cyano(isocyano)methylidene]-4,5,6,7-tetrafluoro-3-isocyanoinden-2-yl]-1,2,3,4-tetrafluorofluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[7-[(1E)-1-[cyano(isocyano)methylidene]-4,5,6,7-tetrafluoro-3-isocyanoinden-2-yl]-1,2,3,4-tetrafluorofluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140872812 |
| Molecular Formula | C29H3F8N5 |
| Molecular Weight | 573.36 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | (2Z)-2-[7-[(1E)-1-[cyano(isocyano)methylidene]-4,5,6,7-tetrafluoro-3-isocyanoinden-2-yl]-1,2,3,4-tetrafluorofluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc3c(c2)/C(=C(\C#N)[N+]#[C-])c2c(F)c(F)c(F)c(F)c2-3)/C(=C(/C#N)[N+]#[C-])c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C29H3F8N5/c1-40-12(7-38)15-11-6-9(4-5-10(11)16-18(15)22(31)26(35)25(34)21(16)30)14-17(13(8-39)41-2)19-20(29(14)42-3)24(33)28(37)27(36)23(19)32/h4-6H/b15-12-,17-13+ |
| InChIKey | WNBFQMOPOGIQLP-AYCYWLMJSA-N |
| XLogP | 7.94 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.36 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|