C34H10F4N6 — CID 140872804
(2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyanoinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 140872804) has the molecular formula C34H10F4N6 and a molecular weight of 578.49 g/mol. Its IUPAC name is (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyanoinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyanoinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140872804 |
| Molecular Formula | C34H10F4N6 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | (2Z)-2-[2-[(9Z)-9-[cyano(isocyano)methylidene]-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]-3-isocyanoinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc3c(c2)/C(=C(\C#N)[N+]#[C-])c2cc(-c4nc(F)c(F)c(F)c4F)ccc2-3)/C(=C(/C#N)[N+]#[C-])c2ccccc21 |
| InChI | InChI=1S/C34H10F4N6/c1-41-24(14-39)27-22-12-16(26-28(25(15-40)42-2)20-6-4-5-7-21(20)33(26)43-3)8-10-18(22)19-11-9-17(13-23(19)27)32-30(36)29(35)31(37)34(38)44-32/h4-13H/b27-24-,28-25- |
| InChIKey | YIWLZCGVRBUSBM-FRUUGIBISA-N |
| XLogP | 8.44 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|