C30H10F3N5O — CID 140872818
(2E)-2-[2-[(3Z)-3-[cyano(isocyano)methylidene]-1-isocyano-5-(trifluoromethoxy)inden-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 140872818) has the molecular formula C30H10F3N5O and a molecular weight of 513.44 g/mol. Its IUPAC name is (2E)-2-[2-[(3Z)-3-[cyano(isocyano)methylidene]-1-isocyano-5-(trifluoromethoxy)inden-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[2-[(3Z)-3-[cyano(isocyano)methylidene]-1-isocyano-5-(trifluoromethoxy)inden-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140872818 |
| Molecular Formula | C30H10F3N5O |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (2E)-2-[2-[(3Z)-3-[cyano(isocyano)methylidene]-1-isocyano-5-(trifluoromethoxy)inden-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc3c(c2)/C(=C(\C#N)[N+]#[C-])c2ccccc2-3)/C(=C(/C#N)[N+]#[C-])c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C30H10F3N5O/c1-36-24(14-34)27-20-7-5-4-6-18(20)19-10-8-16(12-22(19)27)26-28(25(15-35)37-2)23-13-17(39-30(31,32)33)9-11-21(23)29(26)38-3/h4-13H/b27-24+,28-25- |
| InChIKey | VBVUHXJJWPTMIZ-BOQRKYGMSA-N |
| XLogP | 7.72 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|