C34H11F5N6O — CID 159019625
(3E)-3-[cyano(isocyano)methylidene]-2-[4-[(1Z)-1-[cyano(isocyano)methylidene]-3-isocyano-5-(trifluoromethoxy)inden-2-yl]-2,5-difluorophenyl]-6-methylindene-1-carbonitrile (PubChem CID 159019625) has the molecular formula C34H11F5N6O and a molecular weight of 614.49 g/mol. Its IUPAC name is (3E)-3-[cyano(isocyano)methylidene]-2-[4-[(1Z)-1-[cyano(isocyano)methylidene]-3-isocyano-5-(trifluoromethoxy)inden-2-yl]-2,5-difluorophenyl]-6-methylindene-1-carbonitrile.
| Compound Name | (3E)-3-[cyano(isocyano)methylidene]-2-[4-[(1Z)-1-[cyano(isocyano)methylidene]-3-isocyano-5-(trifluoromethoxy)inden-2-yl]-2,5-difluorophenyl]-6-methylindene-1-carbonitrile |
|---|---|
| PubChem CID | 159019625 |
| Molecular Formula | C34H11F5N6O |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | (3E)-3-[cyano(isocyano)methylidene]-2-[4-[(1Z)-1-[cyano(isocyano)methylidene]-3-isocyano-5-(trifluoromethoxy)inden-2-yl]-2,5-difluorophenyl]-6-methylindene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc(F)c(C3=C(C#N)c4cc(C)ccc4/C3=C(/C#N)[N+]#[C-])cc2F)/C(=C(/C#N)[N+]#[C-])c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C34H11F5N6O/c1-16-5-7-18-20(9-16)24(13-40)29(30(18)27(14-41)43-2)22-11-26(36)23(12-25(22)35)32-31(28(15-42)44-3)19-8-6-17(46-34(37,38)39)10-21(19)33(32)45-4/h5-12H,1H3/b30-27+,31-28- |
| InChIKey | OHASBSDGLJJURR-UCOKIVQFSA-N |
| XLogP | 8.73 |
| TPSA | 93.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|