C34H13F3N6 — CID 158868049
(3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile (PubChem CID 158868049) has the molecular formula C34H13F3N6 and a molecular weight of 562.51 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile.
| Compound Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 158868049 |
| Molecular Formula | C34H13F3N6 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2-(4-methylphenyl)-6-[4-(trifluoromethyl)phenyl]-s-indacene-1,7-dicarbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(c2ccc(C)cc2)=C(C#N)c2cc3c(cc21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C(F)(F)F)cc1)=C3C#N |
| InChI | InChI=1S/C34H13F3N6/c1-18-4-6-19(7-5-18)30-26(14-38)22-12-23-25(13-24(22)32(30)28(16-40)42-2)33(29(17-41)43-3)31(27(23)15-39)20-8-10-21(11-9-20)34(35,36)37/h4-13H,1H3/b32-28-,33-29+ |
| InChIKey | VIJSLOXXGVDWAK-VPROMNBDSA-N |
| XLogP | 8.22 |
| TPSA | 103.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|