C37H13F3N8 — CID 165032724
(3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile (PubChem CID 165032724) has the molecular formula C37H13F3N8 and a molecular weight of 626.56 g/mol. Its IUPAC name is (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile.
| Compound Name | (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 165032724 |
| Molecular Formula | C37H13F3N8 |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | (3Z,7Z)-3,7-bis[cyano(isocyano)methylidene]-2-[4-cyano-3-(trifluoromethyl)phenyl]-6-(3,5-dimethylphenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2cc(C)cc(C)c2)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(C#N)c21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C#N)c(C(F)(F)F)c1)=C3C#N |
| InChI | InChI=1S/C37H13F3N8/c1-18-8-19(2)10-22(9-18)31-34(28(16-44)46-3)24-12-23-25(14-42)30(20-6-7-21(13-41)27(11-20)37(38,39)40)35(29(17-45)47-4)32(23)26(15-43)33(24)36(31)48-5/h6-12H,1-2H3/b34-28-,35-29- |
| InChIKey | KRJXEACUSGVRQT-QWCVDIPXSA-N |
| XLogP | 8.62 |
| TPSA | 132.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|