C35H5F4N9 — CID 171766788
(3E,7Z)-2-(4-cyano-2,3-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,3-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile (PubChem CID 171766788) has the molecular formula C35H5F4N9 and a molecular weight of 627.48 g/mol. Its IUPAC name is (3E,7Z)-2-(4-cyano-2,3-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,3-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile.
| Compound Name | (3E,7Z)-2-(4-cyano-2,3-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,3-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 171766788 |
| Molecular Formula | C35H5F4N9 |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | (3E,7Z)-2-(4-cyano-2,3-difluorophenyl)-3,7-bis[cyano(isocyano)methylidene]-6-(2,3-difluoro-4-isocyanophenyl)-5-isocyano-s-indacene-1,4-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc([N+]#[C-])c(F)c2F)/C(=C(/C#N)[N+]#[C-])c2cc3c(c(C#N)c21)/C(=C(/C#N)[N+]#[C-])C(c1ccc(C#N)c(F)c1F)=C3C#N |
| InChI | InChI=1S/C35H5F4N9/c1-45-22-8-7-17(33(38)34(22)39)29-28(23(13-43)46-2)19-9-18-20(11-41)25(16-6-5-15(10-40)31(36)32(16)37)30(24(14-44)47-3)26(18)21(12-42)27(19)35(29)48-4/h5-9H/b28-23-,30-24- |
| InChIKey | XBSJLICMJCSFEV-DDVWKYQUSA-N |
| XLogP | 8.09 |
| TPSA | 136.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|