C26H2F4N12 — CID 171763967
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(4,6-difluoro-1,3,5-triazin-2-yl)-7-isocyano-s-indacene-1-carbonitrile (PubChem CID 171763967) has the molecular formula C26H2F4N12 and a molecular weight of 558.38 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(4,6-difluoro-1,3,5-triazin-2-yl)-7-isocyano-s-indacene-1-carbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(4,6-difluoro-1,3,5-triazin-2-yl)-7-isocyano-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 171763967 |
| Molecular Formula | C26H2F4N12 |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(4,6-difluoro-1,3,5-triazin-2-yl)-7-isocyano-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2nc(F)nc(F)n2)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)C(C#N)=C(c1nc(F)nc(F)n1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C26H2F4N12/c1-34-14(7-32)16-10-5-11-12(4-9(10)13(6-31)18(16)21-37-23(27)41-24(28)38-21)20(36-3)19(17(11)15(8-33)35-2)22-39-25(29)42-26(30)40-22/h4-5H/b16-14+,17-15- |
| InChIKey | SYTGDTJOPUBSKJ-GGTPAPDOSA-N |
| XLogP | 4.17 |
| TPSA | 161.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|