C26H20N6Si2 — CID 153489531
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(trimethylsilyl)-s-indacene-1-carbonitrile (PubChem CID 153489531) has the molecular formula C26H20N6Si2 and a molecular weight of 472.66 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(trimethylsilyl)-s-indacene-1-carbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(trimethylsilyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 153489531 |
| Molecular Formula | C26H20N6Si2 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(trimethylsilyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C([Si](C)(C)C)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)C(C#N)=C([Si](C)(C)C)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C26H20N6Si2/c1-30-20(13-28)22-16-11-17-18(10-15(16)19(12-27)25(22)33(4,5)6)24(32-3)26(34(7,8)9)23(17)21(14-29)31-2/h10-11H,4-9H3/b22-20+,23-21- |
| InChIKey | LKHZQCJPOUOYSS-JKZRTEGISA-N |
| XLogP | 6.68 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|