C34H16N6 — CID 161460886
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(4-methylphenyl)-s-indacene-1-carbonitrile (PubChem CID 161460886) has the molecular formula C34H16N6 and a molecular weight of 508.54 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(4-methylphenyl)-s-indacene-1-carbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(4-methylphenyl)-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 161460886 |
| Molecular Formula | C34H16N6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-7-isocyano-2,6-bis(4-methylphenyl)-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(C)cc2)/C(=C(/C#N)[N+]#[C-])c2cc3c(cc21)C(C#N)=C(c1ccc(C)cc1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C34H16N6/c1-19-6-10-21(11-7-19)30-27(16-35)23-14-26-25(15-24(23)32(30)28(17-36)38-3)33(29(18-37)39-4)31(34(26)40-5)22-12-8-20(2)9-13-22/h6-15H,1-2H3/b32-28+,33-29- |
| InChIKey | CVHSMYMZMHGHNE-RYJJHBMFSA-N |
| XLogP | 7.86 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|