C34H11F5N6 — CID 157401923
(3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-7-isocyano-6-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-s-indacene-1-carbonitrile (PubChem CID 157401923) has the molecular formula C34H11F5N6 and a molecular weight of 598.49 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-7-isocyano-6-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-s-indacene-1-carbonitrile.
| Compound Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-7-isocyano-6-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 157401923 |
| Molecular Formula | C34H11F5N6 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-4,8-difluoro-7-isocyano-6-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(C)cc2)/C(=C(/C#N)[N+]#[C-])c2c(F)c3c(c(F)c21)C(C#N)=C(c1ccc(C(F)(F)F)cc1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C34H11F5N6/c1-16-5-7-18(8-6-16)24-27(22(15-42)44-3)29-30(33(24)45-4)31(35)25-20(13-40)23(17-9-11-19(12-10-17)34(37,38)39)26(21(14-41)43-2)28(25)32(29)36/h5-12H,1H3/b26-21-,27-22+ |
| InChIKey | PELUOJSYRISABT-JWOGCTPDSA-N |
| XLogP | 8.85 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|