C23H3FN8 — CID 166509016
(3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-8-fluoro-6,7-diisocyano-4-methyl-s-indacene-1,2-dicarbonitrile (PubChem CID 166509016) has the molecular formula C23H3FN8 and a molecular weight of 410.33 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-8-fluoro-6,7-diisocyano-4-methyl-s-indacene-1,2-dicarbonitrile.
| Compound Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-8-fluoro-6,7-diisocyano-4-methyl-s-indacene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 166509016 |
| Molecular Formula | C23H3FN8 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (3E,5Z)-3,5-bis[cyano(isocyano)methylidene]-8-fluoro-6,7-diisocyano-4-methyl-s-indacene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C([N+]#[C-])c2c(F)c3c(c(C)c2/C1=C(\C#N)[N+]#[C-])/C(=C(/C#N)[N+]#[C-])C(C#N)=C3C#N |
| InChI | InChI=1S/C23H3FN8/c1-10-15-17(13(8-27)29-2)11(6-25)12(7-26)18(15)21(24)20-16(10)19(14(9-28)30-3)22(31-4)23(20)32-5/h1H3/b17-13-,19-14- |
| InChIKey | VEMLPTLWZYSSNK-PHGFRJIASA-N |
| XLogP | 4.78 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|