C32H6F6N6 — CID 171763991
(3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(3,4-difluorophenyl)-4,8-difluoro-7-isocyano-s-indacene-1-carbonitrile (PubChem CID 171763991) has the molecular formula C32H6F6N6 and a molecular weight of 588.43 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(3,4-difluorophenyl)-4,8-difluoro-7-isocyano-s-indacene-1-carbonitrile.
| Compound Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(3,4-difluorophenyl)-4,8-difluoro-7-isocyano-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 171763991 |
| Molecular Formula | C32H6F6N6 |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | (3Z,5E)-3,5-bis[cyano(isocyano)methylidene]-2,6-bis(3,4-difluorophenyl)-4,8-difluoro-7-isocyano-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccc(F)c(F)c2)/C(=C(/C#N)[N+]#[C-])c2c(F)c3c(c(F)c21)C(C#N)=C(c1ccc(F)c(F)c1)/C3=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C32H6F6N6/c1-42-20(11-40)25-22(13-4-6-16(33)18(35)8-13)15(10-39)24-27(25)31(38)28-26(21(12-41)43-2)23(32(44-3)29(28)30(24)37)14-5-7-17(34)19(36)9-14/h4-9H/b25-20-,26-21+ |
| InChIKey | ZQXAPQUUKUYITN-NTDJFUTDSA-N |
| XLogP | 8.08 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|