C33H7F4N7 — CID 175621926
3,5-bis(dicyanomethylidene)-2,6-bis(3,4-difluorophenyl)-s-indacene-1,7,8-tricarbonitrile (PubChem CID 175621926) has the molecular formula C33H7F4N7 and a molecular weight of 577.46 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-2,6-bis(3,4-difluorophenyl)-s-indacene-1,7,8-tricarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-2,6-bis(3,4-difluorophenyl)-s-indacene-1,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 175621926 |
| Molecular Formula | C33H7F4N7 |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-2,6-bis(3,4-difluorophenyl)-s-indacene-1,7,8-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(F)c(F)c2)=C(C#N)c2c1cc1c(c2C#N)C(C#N)=C(c2ccc(F)c(F)c2)C1=C(C#N)C#N |
| InChI | InChI=1S/C33H7F4N7/c34-24-3-1-15(5-26(24)36)28-21(12-42)32-19(30(28)17(8-38)9-39)7-20-31(18(10-40)11-41)29(16-2-4-25(35)27(37)6-16)22(13-43)33(20)23(32)14-44/h1-7H |
| InChIKey | NPZKADIJIFMUHJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 166.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|