C33H5F8N9 — CID 175623055
3,5-bis(dicyanomethylidene)-2,6-bis[2-fluoro-6-(trifluoromethyl)-4-pyridinyl]-s-indacene-1,7,8-tricarbonitrile (PubChem CID 175623055) has the molecular formula C33H5F8N9 and a molecular weight of 679.45 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-2,6-bis[2-fluoro-6-(trifluoromethyl)-4-pyridinyl]-s-indacene-1,7,8-tricarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-2,6-bis[2-fluoro-6-(trifluoromethyl)-4-pyridinyl]-s-indacene-1,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 175623055 |
| Molecular Formula | C33H5F8N9 |
| Molecular Weight | 679.45 g/mol |
| Exact Mass | 679.05 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-2,6-bis[2-fluoro-6-(trifluoromethyl)-4-pyridinyl]-s-indacene-1,7,8-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(F)nc(C(F)(F)F)c2)=C(C#N)c2c1cc1c(c2C#N)C(C#N)=C(c2cc(F)nc(C(F)(F)F)c2)C1=C(C#N)C#N |
| InChI | InChI=1S/C33H5F8N9/c34-24-3-13(1-22(49-24)32(36,37)38)26-19(10-46)30-17(28(26)15(6-42)7-43)5-18-29(16(8-44)9-45)27(20(11-47)31(18)21(30)12-48)14-2-23(33(39,40)41)50-25(35)4-14/h1-5H |
| InChIKey | YXQGMLAFWRHDRQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 192.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.45 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|