C35HF16N9 — CID 175622493
3,5-bis(dicyanomethylidene)-2,6-bis[3,5-difluoro-2,6-bis(trifluoromethyl)-4-pyridinyl]-s-indacene-1,4,7-tricarbonitrile (PubChem CID 175622493) has the molecular formula C35HF16N9 and a molecular weight of 851.42 g/mol. Its IUPAC name is 3,5-bis(dicyanomethylidene)-2,6-bis[3,5-difluoro-2,6-bis(trifluoromethyl)-4-pyridinyl]-s-indacene-1,4,7-tricarbonitrile.
| Compound Name | 3,5-bis(dicyanomethylidene)-2,6-bis[3,5-difluoro-2,6-bis(trifluoromethyl)-4-pyridinyl]-s-indacene-1,4,7-tricarbonitrile |
|---|---|
| PubChem CID | 175622493 |
| Molecular Formula | C35HF16N9 |
| Molecular Weight | 851.42 g/mol |
| Exact Mass | 851.01 |
| IUPAC Name | 3,5-bis(dicyanomethylidene)-2,6-bis[3,5-difluoro-2,6-bis(trifluoromethyl)-4-pyridinyl]-s-indacene-1,4,7-tricarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2c(F)c(C(F)(F)F)nc(C(F)(F)F)c2F)=C(C#N)c2cc3c(c(C#N)c21)C(=C(C#N)C#N)C(c1c(F)c(C(F)(F)F)nc(C(F)(F)F)c1F)=C3C#N |
| InChI | InChI=1S/C35HF16N9/c36-24-22(25(37)29(33(43,44)45)59-28(24)32(40,41)42)20-13(6-56)11-1-12-14(7-57)21(23-26(38)30(34(46,47)48)60-31(27(23)39)35(49,50)51)17(10(4-54)5-55)19(12)15(8-58)18(11)16(20)9(2-52)3-53/h1H |
| InChIKey | JDJWZGRRUKNEFR-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 192.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.42 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|